Mobile/Wechat/WhatsApp: 18592031892
Email:hiwangqiang@163.com
|
General Description |
Beta-endorphins are naturally occurring neuropeptides that act as neurotransmitters in the brain and are part of the endorphin family. They are produced by the pituitary gland in response to stress or pain and are involved in the body's natural pain management system. Beta-endorphins bind to specific receptors in the brain and spinal cord, leading to the inhibition of pain signals and the promotion of feelings of well-being and euphoria. They are also known to play a role in regulating the body's stress response and modulating mood, appetite, and immune function. Additionally, beta-endorphins have been linked to the "runner's high" experienced during intense physical activity. Due to their role in pain relief and mood regulation, beta-endorphins have been the focus of research for potential therapeutic applications in managing chronic pain, depression, and addiction. |
InChI:InChI=1/C54H77N13O12/c1-32(2)26-41(65-51(76)42(28-33-10-4-3-5-11-33)62-46(71)31-60-45(70)30-61-47(72)38(56)27-34-15-19-36(68)20-16-34)50(75)64-40(13-8-24-59-54(57)58)48(73)63-39(12-6-7-23-55)49(74)66-43(29-35-17-21-37(69)22-18-35)52(77)67-25-9-14-44(67)53(78)79/h3-5,10-11,15-22,32,38-44,68-69H,6-9,12-14,23-31,55-56H2,1-2H3,(H,60,70)(H,61,72)(H,62,71)(H,63,73)(H,64,75)(H,65,76)(H,66,74)(H,78,79)(H4,57,58,59)/t38-,39-,40-,41-,42-,43-,44-/m0/s1