Mobile/Wechat/WhatsApp: 18592031892
Email:hiwangqiang@163.com
|
General Description |
Osteogenic growth peptide (OGP) is a naturally occurring 14-amino acid peptide that has been found to stimulate the development and regeneration of bone tissue. It works by binding to specific receptors on the surface of bone cells, effectively promoting the proliferation and differentiation of osteoblasts, which are the cells responsible for building new bone. Studies have shown that OGP can enhance bone formation, increase bone mineral density, and accelerate fracture healing. As a result, OGP is being investigated as a potential therapeutic agent for the treatment of osteoporosis, bone fractures, and other bone-related conditions. |
InChI:InChI=1/C68H110N22O18/c1-36(2)28-47(87-57(99)38(5)70)64(106)85-44(16-10-11-25-69)61(103)84-45(18-13-27-77-68(74)75)62(104)86-46(23-24-51(71)93)58(100)80-33-53(95)82-43(17-12-26-76-67(72)73)63(105)90-56(39(6)91)66(108)89-48(29-37(3)4)65(107)88-50(31-41-19-21-42(92)22-20-41)60(102)81-34-54(96)83-49(30-40-14-8-7-9-15-40)59(101)79-32-52(94)78-35-55(97)98/h7-9,14-15,19-22,36-39,43-50,56,91-92H,10-13,16-18,23-35,69-70H2,1-6H3,(H2,71,93)(H,78,94)(H,79,101)(H,80,100)(H,81,102)(H,82,95)(H,83,96)(H,84,103)(H,85,106)(H,86,104)(H,87,99)(H,88,107)(H,89,108)(H,90,105)(H,97,98)(H4,72,73,76)(H4,74,75,77)/t38-,39+,43-,44-,45-,46-,47-,48-,49-,50-,56-/m0/s1